C16H19Cl2N5 — CID 111063528
2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-(3,5-dimethylphenyl)guanidine (PubChem CID 111063528) has the molecular formula C16H19Cl2N5 and a molecular weight of 352.27 g/mol. Its IUPAC name is 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-(3,5-dimethylphenyl)guanidine.
| Compound Name | 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-(3,5-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 111063528 |
| Molecular Formula | C16H19Cl2N5 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-(3,5-dimethylphenyl)guanidine |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CCNc2ncc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H19Cl2N5/c1-10-5-11(2)7-13(6-10)23-16(19)21-4-3-20-15-14(18)8-12(17)9-22-15/h5-9H,3-4H2,1-2H3,(H,20,22)(H3,19,21,23) |
| InChIKey | XMQFNGKPLTVAAT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|