C12H17Cl2N5S — CID 111063564
N'-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]thiomorpholine-4-carboximidamide (PubChem CID 111063564) has the molecular formula C12H17Cl2N5S and a molecular weight of 334.28 g/mol. Its IUPAC name is N'-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111063564 |
| Molecular Formula | C12H17Cl2N5S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | N'-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\CCNc1ncc(Cl)cc1Cl)N1CCSCC1 |
| InChI | InChI=1S/C12H17Cl2N5S/c13-9-7-10(14)11(18-8-9)16-1-2-17-12(15)19-3-5-20-6-4-19/h7-8H,1-6H2,(H2,15,17)(H,16,18) |
| InChIKey | VMEGCWRONXYTIO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|