C12H17Cl2IN4O2 — CID 86779305
N'-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 86779305) has the molecular formula C12H17Cl2IN4O2 and a molecular weight of 447.10 g/mol. Its IUPAC name is N'-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 86779305 |
| Molecular Formula | C12H17Cl2IN4O2 |
| Molecular Weight | 447.10 g/mol |
| Exact Mass | 445.98 |
| IUPAC Name | N'-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCOc1ncc(Cl)cc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C12H16Cl2N4O2.HI/c13-9-7-10(14)11(17-8-9)20-4-1-16-12(15)18-2-5-19-6-3-18;/h7-8H,1-6H2,(H2,15,16);1H |
| InChIKey | OIUXHUNBEQQZPC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.10 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|