C13H18Cl2N4O — CID 75426956
N'-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]piperidine-1-carboximidamide (PubChem CID 75426956) has the molecular formula C13H18Cl2N4O and a molecular weight of 317.22 g/mol. Its IUPAC name is N'-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]piperidine-1-carboximidamide.
| Compound Name | N'-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 75426956 |
| Molecular Formula | C13H18Cl2N4O |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N'-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]piperidine-1-carboximidamide |
| SMILES | N/C(=N\CCOc1ncc(Cl)cc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C13H18Cl2N4O/c14-10-8-11(15)12(18-9-10)20-7-4-17-13(16)19-5-2-1-3-6-19/h8-9H,1-7H2,(H2,16,17) |
| InChIKey | GJRLJJDPSWTMHD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|