C12H17Cl2IN4O — CID 110031647
1-cyclopropyl-2-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-1-methylguanidine;hydroiodide (PubChem CID 110031647) has the molecular formula C12H17Cl2IN4O and a molecular weight of 431.11 g/mol. Its IUPAC name is 1-cyclopropyl-2-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-1-methylguanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110031647 |
| Molecular Formula | C12H17Cl2IN4O |
| Molecular Weight | 431.11 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | 1-cyclopropyl-2-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-1-methylguanidine;hydroiodide |
| SMILES | CN(/C(N)=N/CCOc1ncc(Cl)cc1Cl)C1CC1.I |
| InChI | InChI=1S/C12H16Cl2N4O.HI/c1-18(9-2-3-9)12(15)16-4-5-19-11-10(14)6-8(13)7-17-11;/h6-7,9H,2-5H2,1H3,(H2,15,16);1H |
| InChIKey | SJVIMJFWFQDMOF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.11 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|