C14H19Cl2N3 — CID 110030987
1-cyclopropyl-2-[3-(2,4-dichlorophenyl)propyl]-1-methylguanidine (PubChem CID 110030987) has the molecular formula C14H19Cl2N3 and a molecular weight of 300.23 g/mol. Its IUPAC name is 1-cyclopropyl-2-[3-(2,4-dichlorophenyl)propyl]-1-methylguanidine.
| Compound Name | 1-cyclopropyl-2-[3-(2,4-dichlorophenyl)propyl]-1-methylguanidine |
|---|---|
| PubChem CID | 110030987 |
| Molecular Formula | C14H19Cl2N3 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-cyclopropyl-2-[3-(2,4-dichlorophenyl)propyl]-1-methylguanidine |
| SMILES | CN(/C(N)=N/CCCc1ccc(Cl)cc1Cl)C1CC1 |
| InChI | InChI=1S/C14H19Cl2N3/c1-19(12-6-7-12)14(17)18-8-2-3-10-4-5-11(15)9-13(10)16/h4-5,9,12H,2-3,6-8H2,1H3,(H2,17,18) |
| InChIKey | WZCXIIFAEATETJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|