C14H22Cl2IN3O — CID 111600630
2-[3-(2,4-dichlorophenyl)propyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide (PubChem CID 111600630) has the molecular formula C14H22Cl2IN3O and a molecular weight of 446.16 g/mol. Its IUPAC name is 2-[3-(2,4-dichlorophenyl)propyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide.
| Compound Name | 2-[3-(2,4-dichlorophenyl)propyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111600630 |
| Molecular Formula | C14H22Cl2IN3O |
| Molecular Weight | 446.16 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 2-[3-(2,4-dichlorophenyl)propyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide |
| SMILES | COCC(C)N/C(N)=N/CCCc1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C14H21Cl2N3O.HI/c1-10(9-20-2)19-14(17)18-7-3-4-11-5-6-12(15)8-13(11)16;/h5-6,8,10H,3-4,7,9H2,1-2H3,(H3,17,18,19);1H |
| InChIKey | CINFAHBIBSIXDN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.16 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|