C13H20ClN3O2 — CID 111806766
2-[(4-chloro-2-methoxyphenyl)methyl]-1-(1-methoxypropan-2-yl)guanidine (PubChem CID 111806766) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.78 g/mol. Its IUPAC name is 2-[(4-chloro-2-methoxyphenyl)methyl]-1-(1-methoxypropan-2-yl)guanidine.
| Compound Name | 2-[(4-chloro-2-methoxyphenyl)methyl]-1-(1-methoxypropan-2-yl)guanidine |
|---|---|
| PubChem CID | 111806766 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-[(4-chloro-2-methoxyphenyl)methyl]-1-(1-methoxypropan-2-yl)guanidine |
| SMILES | COCC(C)N/C(N)=N/Cc1ccc(Cl)cc1OC |
| InChI | InChI=1S/C13H20ClN3O2/c1-9(8-18-2)17-13(15)16-7-10-4-5-11(14)6-12(10)19-3/h4-6,9H,7-8H2,1-3H3,(H3,15,16,17) |
| InChIKey | OPMOZGXNSDVNGF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|