C13H19Cl3IN3O2 — CID 111859626
1-(1-methoxypropan-2-yl)-2-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide (PubChem CID 111859626) has the molecular formula C13H19Cl3IN3O2 and a molecular weight of 482.58 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-2-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1-methoxypropan-2-yl)-2-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111859626 |
| Molecular Formula | C13H19Cl3IN3O2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 480.96 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-2-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine;hydroiodide |
| SMILES | COCC(C)N/C(N)=N/CCOc1c(Cl)cc(Cl)cc1Cl.I |
| InChI | InChI=1S/C13H18Cl3N3O2.HI/c1-8(7-20-2)19-13(17)18-3-4-21-12-10(15)5-9(14)6-11(12)16;/h5-6,8H,3-4,7H2,1-2H3,(H3,17,18,19);1H |
| InChIKey | BOHKFWUYQVGJME-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|