C15H21ClIN5O2 — CID 111813757
2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide (PubChem CID 111813757) has the molecular formula C15H21ClIN5O2 and a molecular weight of 465.72 g/mol. Its IUPAC name is 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111813757 |
| Molecular Formula | C15H21ClIN5O2 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide |
| SMILES | COCC(C)N/C(N)=N/CCc1nc(-c2cccc(Cl)c2)no1.I |
| InChI | InChI=1S/C15H20ClN5O2.HI/c1-10(9-22-2)19-15(17)18-7-6-13-20-14(21-23-13)11-4-3-5-12(16)8-11;/h3-5,8,10H,6-7,9H2,1-2H3,(H3,17,18,19);1H |
| InChIKey | PQYVFACARZMLBM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|