C18H19ClIN5O2 — CID 111813803
2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(3-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111813803) has the molecular formula C18H19ClIN5O2 and a molecular weight of 499.74 g/mol. Its IUPAC name is 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(3-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(3-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111813803 |
| Molecular Formula | C18H19ClIN5O2 |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(3-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/CCc2nc(-c3cccc(Cl)c3)no2)c1.I |
| InChI | InChI=1S/C18H18ClN5O2.HI/c1-25-15-7-3-6-14(11-15)22-18(20)21-9-8-16-23-17(24-26-16)12-4-2-5-13(19)10-12;/h2-7,10-11H,8-9H2,1H3,(H3,20,21,22);1H |
| InChIKey | YTVNBALTEISKRM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|