C21H24ClN5O3 — CID 111813812
2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(2,5-diethoxyphenyl)guanidine (PubChem CID 111813812) has the molecular formula C21H24ClN5O3 and a molecular weight of 429.91 g/mol. Its IUPAC name is 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(2,5-diethoxyphenyl)guanidine.
| Compound Name | 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(2,5-diethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111813812 |
| Molecular Formula | C21H24ClN5O3 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(2,5-diethoxyphenyl)guanidine |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/CCc2nc(-c3cccc(Cl)c3)no2)c1 |
| InChI | InChI=1S/C21H24ClN5O3/c1-3-28-16-8-9-18(29-4-2)17(13-16)25-21(23)24-11-10-19-26-20(27-30-19)14-6-5-7-15(22)12-14/h5-9,12-13H,3-4,10-11H2,1-2H3,(H3,23,24,25) |
| InChIKey | HAWCJEPDSCKVCR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|