C15H21ClIN5O — CID 111813791
2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 111813791) has the molecular formula C15H21ClIN5O and a molecular weight of 449.72 g/mol. Its IUPAC name is 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111813791 |
| Molecular Formula | C15H21ClIN5O |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | CN(C)C(=NCCc1nc(-c2cccc(Cl)c2)no1)N(C)C.I |
| InChI | InChI=1S/C15H20ClN5O.HI/c1-20(2)15(21(3)4)17-9-8-13-18-14(19-22-13)11-6-5-7-12(16)10-11;/h5-7,10H,8-9H2,1-4H3;1H |
| InChIKey | XXALHTDHVKYCFG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|