C22H28IN5O3 — CID 111036145
1-(3-methoxyphenyl)-2-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]guanidine;hydroiodide (PubChem CID 111036145) has the molecular formula C22H28IN5O3 and a molecular weight of 537.40 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]guanidine;hydroiodide.
| Compound Name | 1-(3-methoxyphenyl)-2-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111036145 |
| Molecular Formula | C22H28IN5O3 |
| Molecular Weight | 537.40 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]guanidine;hydroiodide |
| SMILES | COc1ccc(-c2noc(CCCCC/N=C(\N)Nc3cccc(OC)c3)n2)cc1.I |
| InChI | InChI=1S/C22H27N5O3.HI/c1-28-18-12-10-16(11-13-18)21-26-20(30-27-21)9-4-3-5-14-24-22(23)25-17-7-6-8-19(15-17)29-2;/h6-8,10-13,15H,3-5,9,14H2,1-2H3,(H3,23,24,25);1H |
| InChIKey | YKWCOHSLFBWVNE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|