C17H17ClIN5O2 — CID 111814923
2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111814923) has the molecular formula C17H17ClIN5O2 and a molecular weight of 485.71 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111814923 |
| Molecular Formula | C17H17ClIN5O2 |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 485.01 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2nc(-c3ccc(Cl)cc3)no2)cc1.I |
| InChI | InChI=1S/C17H16ClN5O2.HI/c1-24-14-8-6-13(7-9-14)21-17(19)20-10-15-22-16(23-25-15)11-2-4-12(18)5-3-11;/h2-9H,10H2,1H3,(H3,19,20,21);1H |
| InChIKey | VSIRUOTXKITDKV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|