C18H18N4O3 — CID 50778323
1-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]-3-(4-methoxyphenyl)urea (PubChem CID 50778323) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 1-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 50778323 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]-3-(4-methoxyphenyl)urea |
| SMILES | CCc1nc(-c2ccc(NC(=O)Nc3ccc(OC)cc3)cc2)no1 |
| InChI | InChI=1S/C18H18N4O3/c1-3-16-21-17(22-25-16)12-4-6-13(7-5-12)19-18(23)20-14-8-10-15(24-2)11-9-14/h4-11H,3H2,1-2H3,(H2,19,20,23) |
| InChIKey | QTVFDRUCZHKJCE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |