C14H22IN3 — CID 110029929
1-cyclopropyl-2-[(2,4-dimethylphenyl)methyl]-1-methylguanidine;hydroiodide (PubChem CID 110029929) has the molecular formula C14H22IN3 and a molecular weight of 359.26 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(2,4-dimethylphenyl)methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[(2,4-dimethylphenyl)methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110029929 |
| Molecular Formula | C14H22IN3 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 1-cyclopropyl-2-[(2,4-dimethylphenyl)methyl]-1-methylguanidine;hydroiodide |
| SMILES | Cc1ccc(C/N=C(\N)N(C)C2CC2)c(C)c1.I |
| InChI | InChI=1S/C14H21N3.HI/c1-10-4-5-12(11(2)8-10)9-16-14(15)17(3)13-6-7-13;/h4-5,8,13H,6-7,9H2,1-3H3,(H2,15,16);1H |
| InChIKey | BZGZAYRGLWBASF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|