C11H16N2S — CID 130705429
methyl N'-[(2,4-dimethylphenyl)methyl]carbamimidothioate (PubChem CID 130705429) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is methyl N'-[(2,4-dimethylphenyl)methyl]carbamimidothioate.
| Compound Name | methyl N'-[(2,4-dimethylphenyl)methyl]carbamimidothioate |
|---|---|
| PubChem CID | 130705429 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | methyl N'-[(2,4-dimethylphenyl)methyl]carbamimidothioate |
| SMILES | CS/C(N)=N\Cc1ccc(C)cc1C |
| InChI | InChI=1S/C11H16N2S/c1-8-4-5-10(9(2)6-8)7-13-11(12)14-3/h4-6H,7H2,1-3H3,(H2,12,13) |
| InChIKey | HEBMFKXYFOIWMR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|