C21H23ClN2 — CID 45260142
N'-[(2,4-dimethylphenyl)methyl]-2-naphthalen-2-ylethanimidamide;hydrochloride (PubChem CID 45260142) has the molecular formula C21H23ClN2 and a molecular weight of 338.88 g/mol. Its IUPAC name is N'-[(2,4-dimethylphenyl)methyl]-2-naphthalen-2-ylethanimidamide;hydrochloride.
| Compound Name | N'-[(2,4-dimethylphenyl)methyl]-2-naphthalen-2-ylethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 45260142 |
| Molecular Formula | C21H23ClN2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N'-[(2,4-dimethylphenyl)methyl]-2-naphthalen-2-ylethanimidamide;hydrochloride |
| SMILES | Cc1ccc(C/N=C(\N)Cc2ccc3ccccc3c2)c(C)c1.Cl |
| InChI | InChI=1S/C21H22N2.ClH/c1-15-7-9-20(16(2)11-15)14-23-21(22)13-17-8-10-18-5-3-4-6-19(18)12-17;/h3-12H,13-14H2,1-2H3,(H2,22,23);1H |
| InChIKey | MMSYUXHMPYXGBG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|