C11H15NO — CID 24721590
(NE)-N-[1-(2,4-dimethylphenyl)propan-2-ylidene]hydroxylamine (PubChem CID 24721590) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (NE)-N-[1-(2,4-dimethylphenyl)propan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(2,4-dimethylphenyl)propan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 24721590 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (NE)-N-[1-(2,4-dimethylphenyl)propan-2-ylidene]hydroxylamine |
| SMILES | C/C(Cc1ccc(C)cc1C)=N\O |
| InChI | InChI=1S/C11H15NO/c1-8-4-5-11(9(2)6-8)7-10(3)12-13/h4-6,13H,7H2,1-3H3/b12-10+ |
| InChIKey | NMVMKQXEGZYHSY-ZRDIBKRKSA-N |
| XLogP | 2.70 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|