C11H11NO2 — CID 83530587
2-(2,4-dimethylphenyl)acetyl isocyanate (PubChem CID 83530587) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)acetyl isocyanate.
| Compound Name | 2-(2,4-dimethylphenyl)acetyl isocyanate |
|---|---|
| PubChem CID | 83530587 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-(2,4-dimethylphenyl)acetyl isocyanate |
| SMILES | Cc1ccc(CC(=O)N=C=O)c(C)c1 |
| InChI | InChI=1S/C11H11NO2/c1-8-3-4-10(9(2)5-8)6-11(14)12-7-13/h3-5H,6H2,1-2H3 |
| InChIKey | VIZMYDVUJNQBEI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|