C11H15NO3 — CID 24721588
(NE)-N-[1-(2,4-dimethoxyphenyl)propan-2-ylidene]hydroxylamine (PubChem CID 24721588) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is (NE)-N-[1-(2,4-dimethoxyphenyl)propan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(2,4-dimethoxyphenyl)propan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 24721588 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (NE)-N-[1-(2,4-dimethoxyphenyl)propan-2-ylidene]hydroxylamine |
| SMILES | COc1ccc(C/C(C)=N/O)c(OC)c1 |
| InChI | InChI=1S/C11H15NO3/c1-8(12-13)6-9-4-5-10(14-2)7-11(9)15-3/h4-5,7,13H,6H2,1-3H3/b12-8+ |
| InChIKey | DVQRUOGRERKCTC-XYOKQWHBSA-N |
| XLogP | 2.10 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|