C18H23O7P — CID 69443369
bis[(2,4-dimethoxyphenyl)methyl] hydrogen phosphite (PubChem CID 69443369) has the molecular formula C18H23O7P and a molecular weight of 382.35 g/mol. Its IUPAC name is bis[(2,4-dimethoxyphenyl)methyl] hydrogen phosphite.
| Compound Name | bis[(2,4-dimethoxyphenyl)methyl] hydrogen phosphite |
|---|---|
| PubChem CID | 69443369 |
| Molecular Formula | C18H23O7P |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | bis[(2,4-dimethoxyphenyl)methyl] hydrogen phosphite |
| SMILES | COc1ccc(COP(O)OCc2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C18H23O7P/c1-20-15-7-5-13(17(9-15)22-3)11-24-26(19)25-12-14-6-8-16(21-2)10-18(14)23-4/h5-10,19H,11-12H2,1-4H3 |
| InChIKey | NAMIALUNKOUUCM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|