C10H14O4S — CID 68550384
2-(2,4-dimethoxyphenyl)ethanesulfinic acid (PubChem CID 68550384) has the molecular formula C10H14O4S and a molecular weight of 230.28 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)ethanesulfinic acid.
| Compound Name | 2-(2,4-dimethoxyphenyl)ethanesulfinic acid |
|---|---|
| PubChem CID | 68550384 |
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)ethanesulfinic acid |
| SMILES | COc1ccc(CCS(=O)O)c(OC)c1 |
| InChI | InChI=1S/C10H14O4S/c1-13-9-4-3-8(5-6-15(11)12)10(7-9)14-2/h3-4,7H,5-6H2,1-2H3,(H,11,12) |
| InChIKey | MSUXZBNSDAOOPR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|