C14H17IO4 — CID 24874415
(2,4-dimethoxyphenyl)methyl (E)-4-iodo-3-methylbut-3-enoate (PubChem CID 24874415) has the molecular formula C14H17IO4 and a molecular weight of 376.19 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methyl (E)-4-iodo-3-methylbut-3-enoate.
| Compound Name | (2,4-dimethoxyphenyl)methyl (E)-4-iodo-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 24874415 |
| Molecular Formula | C14H17IO4 |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | (2,4-dimethoxyphenyl)methyl (E)-4-iodo-3-methylbut-3-enoate |
| SMILES | COc1ccc(COC(=O)C/C(C)=C/I)c(OC)c1 |
| InChI | InChI=1S/C14H17IO4/c1-10(8-15)6-14(16)19-9-11-4-5-12(17-2)7-13(11)18-3/h4-5,7-8H,6,9H2,1-3H3/b10-8+ |
| InChIKey | YCCHNFFILKSYOS-CSKARUKUSA-N |
| XLogP | 3.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|