C13H14N2O5 — CID 86687690
(2,4-dimethoxyphenyl)methyl N-(1,3-oxazol-4-yl)carbamate (PubChem CID 86687690) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methyl N-(1,3-oxazol-4-yl)carbamate.
| Compound Name | (2,4-dimethoxyphenyl)methyl N-(1,3-oxazol-4-yl)carbamate |
|---|---|
| PubChem CID | 86687690 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (2,4-dimethoxyphenyl)methyl N-(1,3-oxazol-4-yl)carbamate |
| SMILES | COc1ccc(COC(=O)Nc2cocn2)c(OC)c1 |
| InChI | InChI=1S/C13H14N2O5/c1-17-10-4-3-9(11(5-10)18-2)6-20-13(16)15-12-7-19-8-14-12/h3-5,7-8H,6H2,1-2H3,(H,15,16) |
| InChIKey | IERXEUSHCOLIRV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |