C16H16ClNO4 — CID 134112809
(2,5-dimethoxyphenyl)methyl N-(3-chlorophenyl)carbamate (PubChem CID 134112809) has the molecular formula C16H16ClNO4 and a molecular weight of 321.76 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl N-(3-chlorophenyl)carbamate.
| Compound Name | (2,5-dimethoxyphenyl)methyl N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 134112809 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl N-(3-chlorophenyl)carbamate |
| SMILES | COc1ccc(OC)c(COC(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C16H16ClNO4/c1-20-14-6-7-15(21-2)11(8-14)10-22-16(19)18-13-5-3-4-12(17)9-13/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | AGVRCLNCCIYKLN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |