C16H16O6 — CID 86052866
(3,5-dihydroxyphenyl) 2-(2,4-dimethoxyphenyl)acetate (PubChem CID 86052866) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is (3,5-dihydroxyphenyl) 2-(2,4-dimethoxyphenyl)acetate.
| Compound Name | (3,5-dihydroxyphenyl) 2-(2,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 86052866 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (3,5-dihydroxyphenyl) 2-(2,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)Oc2cc(O)cc(O)c2)c(OC)c1 |
| InChI | InChI=1S/C16H16O6/c1-20-13-4-3-10(15(9-13)21-2)5-16(19)22-14-7-11(17)6-12(18)8-14/h3-4,6-9,17-18H,5H2,1-2H3 |
| InChIKey | BEVWOOGZYZMOBQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|