C21H19NO5S — CID 39768822
[4-(thiophene-2-carbonylamino)phenyl] 2-(2,4-dimethoxyphenyl)acetate (PubChem CID 39768822) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 2-(2,4-dimethoxyphenyl)acetate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 2-(2,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 39768822 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 2-(2,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)Oc2ccc(NC(=O)c3cccs3)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H19NO5S/c1-25-17-8-5-14(18(13-17)26-2)12-20(23)27-16-9-6-15(7-10-16)22-21(24)19-4-3-11-28-19/h3-11,13H,12H2,1-2H3,(H,22,24) |
| InChIKey | LCQQYWHEISNOIS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|