C16H14BrFO4 — CID 55364110
(4-bromo-2-fluorophenyl) 2-(2,4-dimethoxyphenyl)acetate (PubChem CID 55364110) has the molecular formula C16H14BrFO4 and a molecular weight of 369.19 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl) 2-(2,4-dimethoxyphenyl)acetate.
| Compound Name | (4-bromo-2-fluorophenyl) 2-(2,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 55364110 |
| Molecular Formula | C16H14BrFO4 |
| Molecular Weight | 369.19 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | (4-bromo-2-fluorophenyl) 2-(2,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)Oc2ccc(Br)cc2F)c(OC)c1 |
| InChI | InChI=1S/C16H14BrFO4/c1-20-12-5-3-10(15(9-12)21-2)7-16(19)22-14-6-4-11(17)8-13(14)18/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | SZKWWYWSJQSNKT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.19 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|