C19H19F3O3 — CID 135369091
(2-tert-butyl-4-methoxyphenyl) 2-(2,4,5-trifluorophenyl)acetate (PubChem CID 135369091) has the molecular formula C19H19F3O3 and a molecular weight of 352.35 g/mol. Its IUPAC name is (2-tert-butyl-4-methoxyphenyl) 2-(2,4,5-trifluorophenyl)acetate.
| Compound Name | (2-tert-butyl-4-methoxyphenyl) 2-(2,4,5-trifluorophenyl)acetate |
|---|---|
| PubChem CID | 135369091 |
| Molecular Formula | C19H19F3O3 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (2-tert-butyl-4-methoxyphenyl) 2-(2,4,5-trifluorophenyl)acetate |
| SMILES | COc1ccc(OC(=O)Cc2cc(F)c(F)cc2F)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H19F3O3/c1-19(2,3)13-9-12(24-4)5-6-17(13)25-18(23)8-11-7-15(21)16(22)10-14(11)20/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | XFMBBIAGVGUDSL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|