About (2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate
(2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate (PubChem CID 135368910) has the molecular formula C20H24O3
and a molecular weight of 312.41 g/mol. Its IUPAC name is (2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate.
Molecular Properties
| Compound Name | (2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate |
| PubChem CID | 135368910 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate |
| SMILES | COc1ccc(OC(=O)C(C)c2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H24O3/c1-14(15-9-7-6-8-10-15)19(21)23-18-12-11-16(22-5)13-17(18)20(2,3)4/h6-14H,1-5H3 |
| InChIKey | VAGHUXTYZDCPSD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate?
The IUPAC name of (2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate (CID 135368910) is (2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate.
What is the SMILES notation for (2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate?
The canonical SMILES for (2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate is COc1ccc(OC(=O)C(C)c2ccccc2)c(C(C)(C)C)c1.
What is the InChIKey of (2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate?
The InChIKey is VAGHUXTYZDCPSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O3/c1-14(15-9-7-6-8-10-15)19(21)23-18-12-11-16(22-5)13-17(18)20(2,3)4/h6-14H,1-5H3.
What are the key properties of (2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate?
(2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate has a molecular weight of 312.41 g/mol, XLogP of 4.70, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-4-methoxyphenyl) 2-phenylpropanoate is sourced from PubChem (CID 135368910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).