About (2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate
(2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate (PubChem CID 134922138) has the molecular formula C20H24O3
and a molecular weight of 312.41 g/mol. Its IUPAC name is (2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate.
Molecular Properties
| Compound Name | (2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate |
| PubChem CID | 134922138 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate |
| SMILES | COc1ccccc1[C@@H](C)C(=O)Oc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C20H24O3/c1-14(15-10-6-8-12-17(15)22-5)19(21)23-18-13-9-7-11-16(18)20(2,3)4/h6-14H,1-5H3/t14-/m1/s1 |
| InChIKey | TWVLXPJACJEKFA-CQSZACIVSA-N |
| XLogP | 4.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate?
The IUPAC name of (2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate (CID 134922138) is (2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate.
What is the SMILES notation for (2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate?
The canonical SMILES for (2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate is COc1ccccc1[C@@H](C)C(=O)Oc1ccccc1C(C)(C)C.
What is the InChIKey of (2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate?
The InChIKey is TWVLXPJACJEKFA-CQSZACIVSA-N. The full InChI is InChI=1S/C20H24O3/c1-14(15-10-6-8-12-17(15)22-5)19(21)23-18-13-9-7-11-16(18)20(2,3)4/h6-14H,1-5H3/t14-/m1/s1.
What are the key properties of (2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate?
(2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate has a molecular weight of 312.41 g/mol, XLogP of 4.70, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butylphenyl) (2R)-2-(2-methoxyphenyl)propanoate is sourced from PubChem (CID 134922138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).