About ethane;(2-methoxyphenyl) 2-tert-butylbenzoate
ethane;(2-methoxyphenyl) 2-tert-butylbenzoate (PubChem CID 118040465) has the molecular formula C20H26O3
and a molecular weight of 314.43 g/mol. Its IUPAC name is ethane;(2-methoxyphenyl) 2-tert-butylbenzoate.
Molecular Properties
| Compound Name | ethane;(2-methoxyphenyl) 2-tert-butylbenzoate |
| PubChem CID | 118040465 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | ethane;(2-methoxyphenyl) 2-tert-butylbenzoate |
| SMILES | CC.COc1ccccc1OC(=O)c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C18H20O3.C2H6/c1-18(2,3)14-10-6-5-9-13(14)17(19)21-16-12-8-7-11-15(16)20-4;1-2/h5-12H,1-4H3;1-2H3 |
| InChIKey | AALYDKVTYRWTGT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2-methoxyphenyl) 2-tert-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2-methoxyphenyl) 2-tert-butylbenzoate?
The IUPAC name of ethane;(2-methoxyphenyl) 2-tert-butylbenzoate (CID 118040465) is ethane;(2-methoxyphenyl) 2-tert-butylbenzoate.
What is the SMILES notation for ethane;(2-methoxyphenyl) 2-tert-butylbenzoate?
The canonical SMILES for ethane;(2-methoxyphenyl) 2-tert-butylbenzoate is CC.COc1ccccc1OC(=O)c1ccccc1C(C)(C)C.
What is the InChIKey of ethane;(2-methoxyphenyl) 2-tert-butylbenzoate?
The InChIKey is AALYDKVTYRWTGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O3.C2H6/c1-18(2,3)14-10-6-5-9-13(14)17(19)21-16-12-8-7-11-15(16)20-4;1-2/h5-12H,1-4H3;1-2H3.
What are the key properties of ethane;(2-methoxyphenyl) 2-tert-butylbenzoate?
ethane;(2-methoxyphenyl) 2-tert-butylbenzoate has a molecular weight of 314.43 g/mol, XLogP of 5.24, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2-methoxyphenyl) 2-tert-butylbenzoate is sourced from PubChem (CID 118040465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).