C14H12O5S — CID 87011686
2-O-(2-methoxyphenyl) 5-O-methyl thiophene-2,5-dicarboxylate (PubChem CID 87011686) has the molecular formula C14H12O5S and a molecular weight of 292.31 g/mol. Its IUPAC name is 2-O-(2-methoxyphenyl) 5-O-methyl thiophene-2,5-dicarboxylate.
| Compound Name | 2-O-(2-methoxyphenyl) 5-O-methyl thiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 87011686 |
| Molecular Formula | C14H12O5S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-O-(2-methoxyphenyl) 5-O-methyl thiophene-2,5-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Oc2ccccc2OC)s1 |
| InChI | InChI=1S/C14H12O5S/c1-17-9-5-3-4-6-10(9)19-14(16)12-8-7-11(20-12)13(15)18-2/h3-8H,1-2H3 |
| InChIKey | VQCSXHFMTJGQBF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|