C8H6Br2O3S — CID 57362687
methyl 5-(2,2-dibromoacetyl)thiophene-2-carboxylate (PubChem CID 57362687) has the molecular formula C8H6Br2O3S and a molecular weight of 342.01 g/mol. Its IUPAC name is methyl 5-(2,2-dibromoacetyl)thiophene-2-carboxylate.
| Compound Name | methyl 5-(2,2-dibromoacetyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 57362687 |
| Molecular Formula | C8H6Br2O3S |
| Molecular Weight | 342.01 g/mol |
| Exact Mass | 339.84 |
| IUPAC Name | methyl 5-(2,2-dibromoacetyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)C(Br)Br)s1 |
| InChI | InChI=1S/C8H6Br2O3S/c1-13-8(12)5-3-2-4(14-5)6(11)7(9)10/h2-3,7H,1H3 |
| InChIKey | KUVUJIMMHGKZRC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.01 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|