About methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate
methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate (PubChem CID 55964142) has the molecular formula C18H20FNO3S
and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate |
| PubChem CID | 55964142 |
| Molecular Formula | C18H20FNO3S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)NC(c2ccc(F)cc2)C(C)(C)C)s1 |
| InChI | InChI=1S/C18H20FNO3S/c1-18(2,3)15(11-5-7-12(19)8-6-11)20-16(21)13-9-10-14(24-13)17(22)23-4/h5-10,15H,1-4H3,(H,20,21) |
| InChIKey | WBJTWGZFLCAATM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate?
The IUPAC name of methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate (CID 55964142) is methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate?
The canonical SMILES for methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate is COC(=O)c1ccc(C(=O)NC(c2ccc(F)cc2)C(C)(C)C)s1.
What is the InChIKey of methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate?
The InChIKey is WBJTWGZFLCAATM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FNO3S/c1-18(2,3)15(11-5-7-12(19)8-6-11)20-16(21)13-9-10-14(24-13)17(22)23-4/h5-10,15H,1-4H3,(H,20,21).
What are the key properties of methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate?
methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate has a molecular weight of 349.43 g/mol, XLogP of 4.19, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[1-(4-fluorophenyl)-2,2-dimethylpropyl]carbamoyl]thiophene-2-carboxylate is sourced from PubChem (CID 55964142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).