C10H11NO2S — CID 144949550
methyl 5-[(1E)-1-aminobuta-1,3-dien-2-yl]thiophene-2-carboxylate (PubChem CID 144949550) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is methyl 5-[(1E)-1-aminobuta-1,3-dien-2-yl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[(1E)-1-aminobuta-1,3-dien-2-yl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 144949550 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | methyl 5-[(1E)-1-aminobuta-1,3-dien-2-yl]thiophene-2-carboxylate |
| SMILES | C=C/C(=C\N)c1ccc(C(=O)OC)s1 |
| InChI | InChI=1S/C10H11NO2S/c1-3-7(6-11)8-4-5-9(14-8)10(12)13-2/h3-6H,1,11H2,2H3/b7-6+ |
| InChIKey | JMEWMTJXTQOPPM-VOTSOKGWSA-N |
| XLogP | 2.02 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|