About 5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate
5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate (PubChem CID 158503805) has the molecular formula C11H13N3O3S2
and a molecular weight of 299.38 g/mol. Its IUPAC name is 5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate.
Molecular Properties
| Compound Name | 5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate |
| PubChem CID | 158503805 |
| Molecular Formula | C11H13N3O3S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(N)s1.NC(=O)c1ccc(N)s1 |
| InChI | InChI=1S/C6H7NO2S.C5H6N2OS/c1-9-6(8)4-2-3-5(7)10-4;6-4-2-1-3(9-4)5(7)8/h2-3H,7H2,1H3;1-2H,6H2,(H2,7,8) |
| InChIKey | HKFNKNYUIZQVLZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate?
The IUPAC name of 5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate (CID 158503805) is 5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate.
What is the SMILES notation for 5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate?
The canonical SMILES for 5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate is COC(=O)c1ccc(N)s1.NC(=O)c1ccc(N)s1.
What is the InChIKey of 5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate?
The InChIKey is HKFNKNYUIZQVLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S.C5H6N2OS/c1-9-6(8)4-2-3-5(7)10-4;6-4-2-1-3(9-4)5(7)8/h2-3H,7H2,1H3;1-2H,6H2,(H2,7,8).
What are the key properties of 5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate?
5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate has a molecular weight of 299.38 g/mol, XLogP of 1.55, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminothiophene-2-carboxamide;methyl 5-aminothiophene-2-carboxylate is sourced from PubChem (CID 158503805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).