C9H11NO4S — CID 47154054
methyl 5-(ethoxycarbamoyl)thiophene-2-carboxylate (PubChem CID 47154054) has the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. Its IUPAC name is methyl 5-(ethoxycarbamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 5-(ethoxycarbamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 47154054 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | methyl 5-(ethoxycarbamoyl)thiophene-2-carboxylate |
| SMILES | CCONC(=O)c1ccc(C(=O)OC)s1 |
| InChI | InChI=1S/C9H11NO4S/c1-3-14-10-8(11)6-4-5-7(15-6)9(12)13-2/h4-5H,3H2,1-2H3,(H,10,11) |
| InChIKey | GVBCGNHUONIGSI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|