C9H11BrN2O3S — CID 47266709
5-bromo-N-[2-(ethoxyamino)-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 47266709) has the molecular formula C9H11BrN2O3S and a molecular weight of 307.17 g/mol. Its IUPAC name is 5-bromo-N-[2-(ethoxyamino)-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(ethoxyamino)-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 47266709 |
| Molecular Formula | C9H11BrN2O3S |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 5-bromo-N-[2-(ethoxyamino)-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | CCONC(=O)CNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H11BrN2O3S/c1-2-15-12-8(13)5-11-9(14)6-3-4-7(10)16-6/h3-4H,2,5H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | BFCURZAHJJOXMV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|