C15H13Br2N3O3S — CID 55960688
5-bromo-N-[2-[[2-(4-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 55960688) has the molecular formula C15H13Br2N3O3S and a molecular weight of 475.16 g/mol. Its IUPAC name is 5-bromo-N-[2-[[2-(4-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[[2-(4-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55960688 |
| Molecular Formula | C15H13Br2N3O3S |
| Molecular Weight | 475.16 g/mol |
| Exact Mass | 472.90 |
| IUPAC Name | 5-bromo-N-[2-[[2-(4-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(Br)s1)NCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H13Br2N3O3S/c16-9-1-3-10(4-2-9)20-14(22)8-18-13(21)7-19-15(23)11-5-6-12(17)24-11/h1-6H,7-8H2,(H,18,21)(H,19,23)(H,20,22) |
| InChIKey | WESLZKFGCDIAGM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.16 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |