C22H20BrN3O3 — CID 55959917
N-[2-[[2-(4-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl]-2-naphthalen-1-ylacetamide (PubChem CID 55959917) has the molecular formula C22H20BrN3O3 and a molecular weight of 454.32 g/mol. Its IUPAC name is N-[2-[[2-(4-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[2-[[2-(4-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 55959917 |
| Molecular Formula | C22H20BrN3O3 |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-[2-[[2-(4-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl]-2-naphthalen-1-ylacetamide |
| SMILES | O=C(CNC(=O)Cc1cccc2ccccc12)NCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H20BrN3O3/c23-17-8-10-18(11-9-17)26-22(29)14-25-21(28)13-24-20(27)12-16-6-3-5-15-4-1-2-7-19(15)16/h1-11H,12-14H2,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | DOJYVTZOGBKKNA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |