C24H23N3O5 — CID 55441060
methyl 2-[[4-[[2-[(2-naphthalen-1-ylacetyl)amino]acetyl]amino]benzoyl]amino]acetate (PubChem CID 55441060) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is methyl 2-[[4-[[2-[(2-naphthalen-1-ylacetyl)amino]acetyl]amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[[2-[(2-naphthalen-1-ylacetyl)amino]acetyl]amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 55441060 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | methyl 2-[[4-[[2-[(2-naphthalen-1-ylacetyl)amino]acetyl]amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(NC(=O)CNC(=O)Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H23N3O5/c1-32-23(30)15-26-24(31)17-9-11-19(12-10-17)27-22(29)14-25-21(28)13-18-7-4-6-16-5-2-3-8-20(16)18/h2-12H,13-15H2,1H3,(H,25,28)(H,26,31)(H,27,29) |
| InChIKey | QPBSSCFZUYWLNB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |