C27H24N2O2 — CID 7311940
N-(2,4-dimethylphenyl)-4-[(2-naphthalen-1-ylacetyl)amino]benzamide (PubChem CID 7311940) has the molecular formula C27H24N2O2 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-[(2-naphthalen-1-ylacetyl)amino]benzamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-[(2-naphthalen-1-ylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 7311940 |
| Molecular Formula | C27H24N2O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-[(2-naphthalen-1-ylacetyl)amino]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(NC(=O)Cc3cccc4ccccc34)cc2)c(C)c1 |
| InChI | InChI=1S/C27H24N2O2/c1-18-10-15-25(19(2)16-18)29-27(31)21-11-13-23(14-12-21)28-26(30)17-22-8-5-7-20-6-3-4-9-24(20)22/h3-16H,17H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | SFWHDVLQKHAXSH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |