C20H18N2O2 — CID 8700251
N-methyl-4-[(2-naphthalen-1-ylacetyl)amino]benzamide (PubChem CID 8700251) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is N-methyl-4-[(2-naphthalen-1-ylacetyl)amino]benzamide.
| Compound Name | N-methyl-4-[(2-naphthalen-1-ylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 8700251 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-methyl-4-[(2-naphthalen-1-ylacetyl)amino]benzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C20H18N2O2/c1-21-20(24)15-9-11-17(12-10-15)22-19(23)13-16-7-4-6-14-5-2-3-8-18(14)16/h2-12H,13H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | ASJWCWHQUAXENB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |