C12H9Br2N3O3S2 — CID 55821937
5-bromo-N-[2-[2-(5-bromothiophene-2-carbonyl)hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 55821937) has the molecular formula C12H9Br2N3O3S2 and a molecular weight of 467.16 g/mol. Its IUPAC name is 5-bromo-N-[2-[2-(5-bromothiophene-2-carbonyl)hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[2-(5-bromothiophene-2-carbonyl)hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55821937 |
| Molecular Formula | C12H9Br2N3O3S2 |
| Molecular Weight | 467.16 g/mol |
| Exact Mass | 464.85 |
| IUPAC Name | 5-bromo-N-[2-[2-(5-bromothiophene-2-carbonyl)hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(Br)s1)NNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C12H9Br2N3O3S2/c13-8-3-1-6(21-8)11(19)15-5-10(18)16-17-12(20)7-2-4-9(14)22-7/h1-4H,5H2,(H,15,19)(H,16,18)(H,17,20) |
| InChIKey | GUJBXQQWHORXCQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|