C11H13BrN2O4S — CID 47337781
methyl (2S)-2-[[2-[(5-bromothiophene-2-carbonyl)amino]acetyl]amino]propanoate (PubChem CID 47337781) has the molecular formula C11H13BrN2O4S and a molecular weight of 349.21 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[(5-bromothiophene-2-carbonyl)amino]acetyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[2-[(5-bromothiophene-2-carbonyl)amino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 47337781 |
| Molecular Formula | C11H13BrN2O4S |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | methyl (2S)-2-[[2-[(5-bromothiophene-2-carbonyl)amino]acetyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)CNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H13BrN2O4S/c1-6(11(17)18-2)14-9(15)5-13-10(16)7-3-4-8(12)19-7/h3-4,6H,5H2,1-2H3,(H,13,16)(H,14,15)/t6-/m0/s1 |
| InChIKey | WKNAHMJWFXUYRR-LURJTMIESA-N |
| XLogP | 0.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |