C9H11BrN2OS2 — CID 62666717
N-(3-amino-2-methyl-3-sulfanylidenepropyl)-5-bromothiophene-2-carboxamide (PubChem CID 62666717) has the molecular formula C9H11BrN2OS2 and a molecular weight of 307.24 g/mol. Its IUPAC name is N-(3-amino-2-methyl-3-sulfanylidenepropyl)-5-bromothiophene-2-carboxamide.
| Compound Name | N-(3-amino-2-methyl-3-sulfanylidenepropyl)-5-bromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 62666717 |
| Molecular Formula | C9H11BrN2OS2 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | N-(3-amino-2-methyl-3-sulfanylidenepropyl)-5-bromothiophene-2-carboxamide |
| SMILES | CC(CNC(=O)c1ccc(Br)s1)C(N)=S |
| InChI | InChI=1S/C9H11BrN2OS2/c1-5(8(11)14)4-12-9(13)6-2-3-7(10)15-6/h2-3,5H,4H2,1H3,(H2,11,14)(H,12,13) |
| InChIKey | FJXZGHROYYYIBM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|