C9H12BrNO2S — CID 115409767
5-bromo-N-(2-methylpropoxy)thiophene-2-carboxamide (PubChem CID 115409767) has the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. Its IUPAC name is 5-bromo-N-(2-methylpropoxy)thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(2-methylpropoxy)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 115409767 |
| Molecular Formula | C9H12BrNO2S |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 5-bromo-N-(2-methylpropoxy)thiophene-2-carboxamide |
| SMILES | CC(C)CONC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H12BrNO2S/c1-6(2)5-13-11-9(12)7-3-4-8(10)14-7/h3-4,6H,5H2,1-2H3,(H,11,12) |
| InChIKey | GXZKYQGPVYPHIN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|